cas: 1073371-92-2 — see every product listed under this CAS number, including other names
Morpholino(5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl)methanone 98% (CAS 1073371-92-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A157526-100mg |
| cas | 1073371-92-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 565.06 Pln | |
| Ambeed | 250mg | 998.94 Pln | |
| Ambeed | 1g | 2489.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A157526 |
Morpholin-4-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]methanone (CAS 1073371-92-2) is a chemical compound with the molecular formula C16H23BN2O4 and a molecular weight of 318.2 g/mol. IUPAC name: morpholin-4-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]methanone. InChIKey: IEAOXNVWSKRLFT-UHFFFAOYSA-N.
| Molecular formula | C16H23BN2O4 |
|---|---|
| Molecular weight | 318.2 g/mol |
| IUPAC name | morpholin-4-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]methanone |
| InChIKey | IEAOXNVWSKRLFT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)C(=O)N3CCOCC3 |
Computed by PubChem (NCBI)