cas: 1421372-66-8 — see every product listed under this CAS number, including other names
Mutated EGFR-IN-1 98% (CAS 1421372-66-8) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1mg, 10mg, 50mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A111360-500g |
| cas | 1421372-66-8 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 11762.38 Pln | |
| Ambeed | 1mg | 120.06 Pln | |
| Ambeed | 10mg | 147.88 Pln | |
| Ambeed | 50mg | 164.56 Pln | |
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 337.00 Pln | |
| Ambeed | 25g | 954.44 Pln | |
| Ambeed | 100g | 2990.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A111360 |
1-N-[2-(dimethylamino)ethyl]-5-methoxy-1-N-methyl-4-N-[4-(1-methylindol-3-yl)pyrimidin-2-yl]benzene-1,2,4-triamine (CAS 1421372-66-8) is a chemical compound with the molecular formula C25H31N7O and a molecular weight of 445.6 g/mol. IUPAC name: 1-N-[2-(dimethylamino)ethyl]-5-methoxy-1-N-methyl-4-N-[4-(1-methylindol-3-yl)pyrimidin-2-yl]benzene-1,2,4-triamine. InChIKey: HTNTZPBKKCORTP-UHFFFAOYSA-N.
| Molecular formula | C25H31N7O |
|---|---|
| Molecular weight | 445.6 g/mol |
| IUPAC name | 1-N-[2-(dimethylamino)ethyl]-5-methoxy-1-N-methyl-4-N-[4-(1-methylindol-3-yl)pyrimidin-2-yl]benzene-1,2,4-triamine |
| InChIKey | HTNTZPBKKCORTP-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)C3=NC(=NC=C3)NC4=C(C=C(C(=C4)N)N(C)CCN(C)C)OC |
Computed by PubChem (NCBI)