cas: 110406-94-5 — see every product listed under this CAS number, including other names
N'-(1-Methylazepan-4-yl)benzohydrazide, 95%, 95% (CAS 110406-94-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110740-100mg |
| cas | 110406-94-5 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1456.40 Pln | |
| Chemat | 250mg | 2051.60 Pln | |
| Chemat | 1g | 4029.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N'-(1-methylazepan-4-yl)benzohydrazide (CAS 110406-94-5) is a chemical compound with the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. IUPAC name: N'-(1-methylazepan-4-yl)benzohydrazide. InChIKey: HJCSHXABAVJCGJ-UHFFFAOYSA-N.
| Molecular formula | C14H21N3O |
|---|---|
| Molecular weight | 247.34 g/mol |
| IUPAC name | N'-(1-methylazepan-4-yl)benzohydrazide |
| InChIKey | HJCSHXABAVJCGJ-UHFFFAOYSA-N |
| SMILES | CN1CCCC(CC1)NNC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)