cas: 121788-77-0 — see every product listed under this CAS number, including other names
N,N'-((1S,2S)-1,2-diphenylethane-1,2-diyl)bis(1,1,1-trifluoromethanesulfonamide), 98%, 98% (CAS 121788-77-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100g, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11272C-10g |
| cas | 121788-77-0 |
| size | 10g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 390.80 Pln | |
| Chemat | 100g | 2085.20 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 242.00 Pln | |
| Chemat | 25g | 669.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-[(1S,2S)-1,2-diphenyl-2-(trifluoromethylsulfonylamino)ethyl]-1,1,1-trifluoromethanesulfonamide (CAS 121788-77-0) is a chemical compound with the molecular formula C16H14F6N2O4S2 and a molecular weight of 476.4 g/mol. IUPAC name: N-[(1S,2S)-1,2-diphenyl-2-(trifluoromethylsulfonylamino)ethyl]-1,1,1-trifluoromethanesulfonamide. InChIKey: XQAIGOHPAZPGOU-KBPBESRZSA-N.
| Molecular formula | C16H14F6N2O4S2 |
|---|---|
| Molecular weight | 476.4 g/mol |
| IUPAC name | N-[(1S,2S)-1,2-diphenyl-2-(trifluoromethylsulfonylamino)ethyl]-1,1,1-trifluoromethanesulfonamide |
| InChIKey | XQAIGOHPAZPGOU-KBPBESRZSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H]([C@H](C2=CC=CC=C2)NS(=O)(=O)C(F)(F)F)NS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)