Products 3024621-03-9

CAS 3024621-03-9 is the registry number for N,N'-(Cyclohexane-1,4-diyl)bis(P,P-diphenylphosphinic amide), 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

1-N,4-N-bis(diphenylphosphoryl)cyclohexane-1,4-diamine (CAS 3024621-03-9) is a chemical compound with the molecular formula C30H32N2O2P2 and a molecular weight of 514.5 g/mol. IUPAC name: 1-N,4-N-bis(diphenylphosphoryl)cyclohexane-1,4-diamine. InChIKey: BSBNNWJIWNYGQL-UHFFFAOYSA-N.

Identity
Molecular formulaC30H32N2O2P2
Molecular weight514.5 g/mol
IUPAC name1-N,4-N-bis(diphenylphosphoryl)cyclohexane-1,4-diamine
InChIKeyBSBNNWJIWNYGQL-UHFFFAOYSA-N
SMILESC1CC(CCC1NP(=O)(C2=CC=CC=C2)C3=CC=CC=C3)NP(=O)(C4=CC=CC=C4)C5=CC=CC=C5

Computed by PubChem (NCBI)