N,N'-Bis(3-methylphenyl)-N,N'-bis(phenyl)-2,7-diamino-9,9-dimethyl-fluorene, 99% (CAS 677350-83-3) manufactured by Lumtec in a 1g pack.
| brand | Lumtec |
|---|---|
| catalog number | LT-E109-1g |
| cas | 677350-83-3 |
| size | 1g |
| availability | 12.11.2021: In Stock |
Ask us about this product — we're happy to help.
| purity | 99% |
|---|
9,9-dimethyl-2-N,7-N-bis(3-methylphenyl)-2-N,7-N-diphenylfluorene-2,7-diamine (CAS 677350-83-3) is a chemical compound with the molecular formula C41H36N2 and a molecular weight of 556.7 g/mol. IUPAC name: 9,9-dimethyl-2-N,7-N-bis(3-methylphenyl)-2-N,7-N-diphenylfluorene-2,7-diamine. InChIKey: YUBXDAMWVRMLOG-UHFFFAOYSA-N.
| Molecular formula | C41H36N2 |
|---|---|
| Molecular weight | 556.7 g/mol |
| IUPAC name | 9,9-dimethyl-2-N,7-N-bis(3-methylphenyl)-2-N,7-N-diphenylfluorene-2,7-diamine |
| InChIKey | YUBXDAMWVRMLOG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N(C2=CC=CC=C2)C3=CC4=C(C=C3)C5=C(C4(C)C)C=C(C=C5)N(C6=CC=CC=C6)C7=CC=CC(=C7)C |
Computed by PubChem (NCBI)