N,N'-Bis(naphthalen-1-yl)-N,N'-bis(phenyl)-2,2'-dimethylbenzidine, 99% (CAS 495416-60-9) manufactured by Lumtec in a 1g pack.
| brand | Lumtec |
|---|---|
| catalog number | LT-E115-1g |
| cas | 495416-60-9 |
| size | 1g |
| availability | 12.11.2021: In Stock |
Ask us about this product — we're happy to help.
| purity | 99% |
|---|
N-[3-methyl-4-[2-methyl-4-(N-naphthalen-1-ylanilino)phenyl]phenyl]-N-phenylnaphthalen-1-amine (CAS 495416-60-9) is a chemical compound with the molecular formula C46H36N2 and a molecular weight of 616.8 g/mol. IUPAC name: N-[3-methyl-4-[2-methyl-4-(N-naphthalen-1-ylanilino)phenyl]phenyl]-N-phenylnaphthalen-1-amine. InChIKey: ZJFKMIYGRJGWIB-UHFFFAOYSA-N.
| Molecular formula | C46H36N2 |
|---|---|
| Molecular weight | 616.8 g/mol |
| IUPAC name | N-[3-methyl-4-[2-methyl-4-(N-naphthalen-1-ylanilino)phenyl]phenyl]-N-phenylnaphthalen-1-amine |
| InChIKey | ZJFKMIYGRJGWIB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N(C2=CC=CC=C2)C3=CC=CC4=CC=CC=C43)C5=C(C=C(C=C5)N(C6=CC=CC=C6)C7=CC=CC8=CC=CC=C87)C |
Computed by PubChem (NCBI)