N,N'-Bis(phenanthren-9-yl)-N,N'-bis(phenyl)-benzidine, 99% (CAS 934000-87-0) manufactured by Lumtec in a 1g pack.
| brand | Lumtec |
|---|---|
| catalog number | LT-N131-1g |
| cas | 934000-87-0 |
| size | 1g |
| availability | 12.11.2021: In Stock |
Ask us about this product — we're happy to help.
| purity | 99% |
|---|
N-[4-[4-(N-phenanthren-9-ylanilino)phenyl]phenyl]-N-phenylphenanthren-9-amine (CAS 934000-87-0) is a chemical compound with the molecular formula C52H36N2 and a molecular weight of 688.9 g/mol. IUPAC name: N-[4-[4-(N-phenanthren-9-ylanilino)phenyl]phenyl]-N-phenylphenanthren-9-amine. InChIKey: LBFXFIPIIMAZPK-UHFFFAOYSA-N.
| Molecular formula | C52H36N2 |
|---|---|
| Molecular weight | 688.9 g/mol |
| IUPAC name | N-[4-[4-(N-phenanthren-9-ylanilino)phenyl]phenyl]-N-phenylphenanthren-9-amine |
| InChIKey | LBFXFIPIIMAZPK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=C(C=C2)C3=CC=C(C=C3)N(C4=CC=CC=C4)C5=CC6=CC=CC=C6C7=CC=CC=C75)C8=CC9=CC=CC=C9C1=CC=CC=C18 |
Computed by PubChem (NCBI)