CAS 663943-27-9 appears in our catalog under these names: N,N–Bis(4–bromophenyl)–2,4,6–trimethylaniline, N,N-Bis(4-bromophenyl)-2,4,6-trimethylaniline, 99%, 99%, N,N-Bis(4-bromophenyl)-2,4,6-trimethylaniline, 99%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 15g, 25g.
N,N-bis(4-bromophenyl)-2,4,6-trimethylaniline (CAS 663943-27-9) is a chemical compound with the molecular formula C21H19Br2N and a molecular weight of 445.2 g/mol. IUPAC name: N,N-bis(4-bromophenyl)-2,4,6-trimethylaniline. InChIKey: XZCBYXUKPMELOQ-UHFFFAOYSA-N.
| Molecular formula | C21H19Br2N |
|---|---|
| Molecular weight | 445.2 g/mol |
| IUPAC name | N,N-bis(4-bromophenyl)-2,4,6-trimethylaniline |
| InChIKey | XZCBYXUKPMELOQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)N(C2=CC=C(C=C2)Br)C3=CC=C(C=C3)Br)C |
Computed by PubChem (NCBI)