cas: 28489-43-2 — see every product listed under this CAS number, including other names
N,N-DIethyl-6-methyl-5-nitro-2-pyridinamine 95% (CAS 28489-43-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A984862-5g |
| cas | 28489-43-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 286.94 Pln | |
| Ambeed | 10g | 375.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A984862 |
N,N-diethyl-6-methyl-5-nitropyridin-2-amine (CAS 28489-43-2) is a chemical compound with the molecular formula C10H15N3O2 and a molecular weight of 209.24 g/mol. IUPAC name: N,N-diethyl-6-methyl-5-nitropyridin-2-amine. InChIKey: CXYAEVLXLIHNDQ-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O2 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | N,N-diethyl-6-methyl-5-nitropyridin-2-amine |
| InChIKey | CXYAEVLXLIHNDQ-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=NC(=C(C=C1)[N+](=O)[O-])C |
Computed by PubChem (NCBI)