cas: 892501-92-7 — see every product listed under this CAS number, including other names
N,N-Dimethyl-2-((5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)oxy)ethanamine, 95% (CAS 892501-92-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F460116-250MG |
| cas | 892501-92-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1320.39 Pln | |
| Fluorochem | 1g | 3309.27 Pln | |
| Fluorochem | 5g | 9760.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
N,N-dimethyl-2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]ethanamine (CAS 892501-92-7) is a chemical compound with the molecular formula C15H25BN2O3 and a molecular weight of 292.18 g/mol. IUPAC name: N,N-dimethyl-2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]ethanamine. InChIKey: RZRVDAUYLZPDKW-UHFFFAOYSA-N.
| Molecular formula | C15H25BN2O3 |
|---|---|
| Molecular weight | 292.18 g/mol |
| IUPAC name | N,N-dimethyl-2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]ethanamine |
| InChIKey | RZRVDAUYLZPDKW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)OCCN(C)C |
Computed by PubChem (NCBI)