cas: 1007126-41-1 — see every product listed under this CAS number, including other names
N,N-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-amine, 98% (CAS 1007126-41-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F213063-100MG |
| cas | 1007126-41-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 299.91 Pln | |
| Fluorochem | 250mg | 456.11 Pln | |
| Fluorochem | 1g | 1268.32 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-amine (CAS 1007126-41-1) is a chemical compound with the molecular formula C18H24BNO2 and a molecular weight of 297.2 g/mol. IUPAC name: N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-amine. InChIKey: JXQGIGJKFBLRGA-UHFFFAOYSA-N.
| Molecular formula | C18H24BNO2 |
|---|---|
| Molecular weight | 297.2 g/mol |
| IUPAC name | N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-amine |
| InChIKey | JXQGIGJKFBLRGA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C3=CC=CC=C23)N(C)C |
Computed by PubChem (NCBI)