cas: 1443037-13-5 — see every product listed under this CAS number, including other names
N,N-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)picolinamide 95% (CAS 1443037-13-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1224854-250mg |
| cas | 1443037-13-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 2600.94 Pln | |
| Ambeed | 1g | 3134.94 Pln | |
| Ambeed | 5g | 9264.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1224854 |
N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxamide (CAS 1443037-13-5) is a chemical compound with the molecular formula C14H21BN2O3 and a molecular weight of 276.14 g/mol. IUPAC name: N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxamide. InChIKey: LFXNNWLRLADZSL-UHFFFAOYSA-N.
| Molecular formula | C14H21BN2O3 |
|---|---|
| Molecular weight | 276.14 g/mol |
| IUPAC name | N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxamide |
| InChIKey | LFXNNWLRLADZSL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2)C(=O)N(C)C |
Computed by PubChem (NCBI)