N,N-Dimethyl-4-(pentafluoro-l6-sulfanyl)aniline, 95%
cas: 1427763-15-2 — see every product listed under this CAS number, including other names
N,N-Dimethyl-4-(pentafluoro-l6-sulfanyl)aniline, 95% (CAS 1427763-15-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1502137-100mg |
| cas | 1427763-15-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 314.75 Pln | |
| Ambeed | 250mg | 476.06 Pln | |
| Ambeed | 1g | 1176.94 Pln | |
| Ambeed | 5g | 3908.12 Pln | |
| Chemat | 100mg | 275.60 Pln | |
| Chemat | 250mg | 424.40 Pln | |
| Chemat | 1g | 1034.00 Pln | |
| Chemat | 5g | 3458.00 Pln | |
| BLDpharm | 100mg | 303.25 Pln | |
| BLDpharm | 250mg | 469.86 Pln | |
| BLDpharm | 1g | 1152.95 Pln | |
| BLDpharm | 5g | 3835.34 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
N,N-dimethyl-4-(pentafluoro-lambda6-sulfanyl)aniline (CAS 1427763-15-2) is a chemical compound with the molecular formula C8H10F5NS and a molecular weight of 247.23 g/mol. IUPAC name: N,N-dimethyl-4-(pentafluoro-lambda6-sulfanyl)aniline. InChIKey: LPYIRLBXLHFEAX-UHFFFAOYSA-N.
| Molecular formula | C8H10F5NS |
|---|---|
| Molecular weight | 247.23 g/mol |
| IUPAC name | N,N-dimethyl-4-(pentafluoro-lambda6-sulfanyl)aniline |
| InChIKey | LPYIRLBXLHFEAX-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)S(F)(F)(F)(F)F |
Computed by PubChem (NCBI)