cas: 36805-97-7 — see every product listed under this CAS number, including other names
N,N-Dimethylformamide Di-tert-butyl Acetal [for Esterification], >98.0%(N) (CAS 36805-97-7) is a chemical reagent available from Chemat. Available pack sizes: 5ml, 25ml. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D1303-5ML |
| cas | 36805-97-7 |
| size | 5ml |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5ml | 532.88 Pln | |
| TCI | 25ml | 1462.24 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(N) |
N,N-dimethyl-1,1-bis[(2-methylpropan-2-yl)oxy]methanamine (CAS 36805-97-7) is a chemical compound with the molecular formula C11H25NO2 and a molecular weight of 203.32 g/mol. IUPAC name: N,N-dimethyl-1,1-bis[(2-methylpropan-2-yl)oxy]methanamine. InChIKey: DBNQIOANXZVWIP-UHFFFAOYSA-N.
| Molecular formula | C11H25NO2 |
|---|---|
| Molecular weight | 203.32 g/mol |
| IUPAC name | N,N-dimethyl-1,1-bis[(2-methylpropan-2-yl)oxy]methanamine |
| InChIKey | DBNQIOANXZVWIP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(N(C)C)OC(C)(C)C |
Computed by PubChem (NCBI)