cas: 1427316-55-9 — see every product listed under this CAS number, including other names
N,9-Diphenyl-9H-carbazol-2-amine, 98%, 98% (CAS 1427316-55-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JY1E-1g |
| cas | 1427316-55-9 |
| size | 1g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 304.40 Pln | |
| Chemat | 10g | 477.20 Pln | |
| Chemat | 25g | 890.00 Pln | |
| Chemat | 50g | 1442.00 Pln | |
| Chemat | 100g | 2267.60 Pln | |
| Chemat | 250g | 4610.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N,9-diphenylcarbazol-2-amine (CAS 1427316-55-9) is a chemical compound with the molecular formula C24H18N2 and a molecular weight of 334.4 g/mol. IUPAC name: N,9-diphenylcarbazol-2-amine. InChIKey: ZHVOQKHZCNGWET-UHFFFAOYSA-N.
| Molecular formula | C24H18N2 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | N,9-diphenylcarbazol-2-amine |
| InChIKey | ZHVOQKHZCNGWET-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC3=C(C=C2)C4=CC=CC=C4N3C5=CC=CC=C5 |
Computed by PubChem (NCBI)