cas: 112724-95-5 — see every product listed under this CAS number, including other names
N,N-Bis(2-ethylhexyl)-2-methylpropanamide, 95%, 95% (CAS 112724-95-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FPPV-1g |
| cas | 112724-95-5 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 371.60 Pln | |
| Chemat | 5g | 1096.40 Pln | |
| Chemat | 10g | 1782.80 Pln | |
| Chemat | 25g | 3506.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N,N-bis(2-ethylhexyl)-2-methylpropanamide (CAS 112724-95-5) is a chemical compound with the molecular formula C20H41NO and a molecular weight of 311.5 g/mol. IUPAC name: N,N-bis(2-ethylhexyl)-2-methylpropanamide. InChIKey: TYDFWJHDNHXBRF-UHFFFAOYSA-N.
| Molecular formula | C20H41NO |
|---|---|
| Molecular weight | 311.5 g/mol |
| IUPAC name | N,N-bis(2-ethylhexyl)-2-methylpropanamide |
| InChIKey | TYDFWJHDNHXBRF-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)C(=O)C(C)C |
Computed by PubChem (NCBI)