cas: 215394-03-9 — see every product listed under this CAS number, including other names
N,N-bis(2-ethylhexyl)-2,2-dimethylpropanamide, 95%, 95% (CAS 215394-03-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FPY7-1g |
| cas | 215394-03-9 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 352.40 Pln | |
| Chemat | 10g | 530.00 Pln | |
| Chemat | 25g | 990.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N,N-bis(2-ethylhexyl)-2,2-dimethylpropanamide (CAS 215394-03-9) is a chemical compound with the molecular formula C21H43NO and a molecular weight of 325.6 g/mol. IUPAC name: N,N-bis(2-ethylhexyl)-2,2-dimethylpropanamide. InChIKey: ODFOPGYFSLHCQS-UHFFFAOYSA-N.
| Molecular formula | C21H43NO |
|---|---|
| Molecular weight | 325.6 g/mol |
| IUPAC name | N,N-bis(2-ethylhexyl)-2,2-dimethylpropanamide |
| InChIKey | ODFOPGYFSLHCQS-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)C(=O)C(C)(C)C |
Computed by PubChem (NCBI)