cas: 2248763-87-1 — see every product listed under this CAS number, including other names
N,N-diisopropyl-2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 95%, 95% (CAS 2248763-87-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FTMH-100mg |
| cas | 2248763-87-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 611.60 Pln | |
| Chemat | 1g | 1715.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-methoxy-N,N-di(propan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 2248763-87-1) is a chemical compound with the molecular formula C20H32BNO4 and a molecular weight of 361.3 g/mol. IUPAC name: 2-methoxy-N,N-di(propan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: UCCMSCZQQVGKQG-UHFFFAOYSA-N.
| Molecular formula | C20H32BNO4 |
|---|---|
| Molecular weight | 361.3 g/mol |
| IUPAC name | 2-methoxy-N,N-di(propan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | UCCMSCZQQVGKQG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(=O)N(C(C)C)C(C)C)OC |
Computed by PubChem (NCBI)