CAS 146346-81-8 appears in our catalog under these names: Fmoc-Ser(TBDMS)-OH, >95% (HPLC), Fmoc–Ser(BSi)–OH, Fmoc-L-Ser(TBDMS)-OH, Fmoc-O-tert-butyldimethylsilyl-L-serine, Fmoc-Ser(TBDMS)-OH, 97%, 97%. Offered by: TRC, GLPBio, Iris Biotech, Biosynth, Chemat. Available pack sizes: 1g, 500mg, 5g, 10g, 25g, 5 g, 10 g, 100g.
(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 146346-81-8) is a chemical compound with the molecular formula C24H31NO5Si and a molecular weight of 441.6 g/mol. IUPAC name: (2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: IONOZYFSQPGBAT-NRFANRHFSA-N.
| Molecular formula | C24H31NO5Si |
|---|---|
| Molecular weight | 441.6 g/mol |
| IUPAC name | (2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | IONOZYFSQPGBAT-NRFANRHFSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)