cas: 501326-55-2 — see every product listed under this CAS number, including other names
N-(((9H-fluoren-9-yl)methoxy)carbonyl)-S-(tert-butylthio)-D-cysteine, 98% (CAS 501326-55-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F729896-25G |
| cas | 501326-55-2 |
| size | 25g |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 10213.09 Pln | |
| BLDpharm | 100mg | 603.15 Pln | |
| BLDpharm | 250mg | 1064.09 Pln | |
| BLDpharm | 1g | 2108.17 Pln | |
| BLDpharm | 5g | 7139.73 Pln | |
| BLDpharm | 10g | 12398.99 Pln | |
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 518.59 Pln | |
| Fluorochem | 1g | 1388.07 Pln | |
| Fluorochem | 5g | 3007.29 Pln | |
| Fluorochem | 10g | 4990.97 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(2S)-3-(tert-butyldisulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 501326-55-2) is a chemical compound with the molecular formula C22H25NO4S2 and a molecular weight of 431.6 g/mol. IUPAC name: (2S)-3-(tert-butyldisulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: ZDUMTHLUTJOUML-LJQANCHMSA-N.
| Molecular formula | C22H25NO4S2 |
|---|---|
| Molecular weight | 431.6 g/mol |
| IUPAC name | (2S)-3-(tert-butyldisulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | ZDUMTHLUTJOUML-LJQANCHMSA-N |
| SMILES | CC(C)(C)SSC[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)