N-((1R,2R,3S)-2-Hydroxy-3-(10H-phenoxazin-10-yl)cyclohexyl)-4-(trifluoromethoxy)benzenesulfonamide, 99%
cas: 1809427-19-7 — see every product listed under this CAS number, including other names
N-((1R,2R,3S)-2-Hydroxy-3-(10H-phenoxazin-10-yl)cyclohexyl)-4-(trifluoromethoxy)benzenesulfonamide, 99% (CAS 1809427-19-7) is a chemical reagent available from Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg. Offered by: BLDpharm, Chemat.
| brand | BLDpharm |
|---|---|
| catalog number | BD01098221-2mg |
| cas | 1809427-19-7 |
| size | 2mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 2mg | 747.54 Pln | |
| BLDpharm | 5mg | 1230.70 Pln | |
| BLDpharm | 10mg | 2035.97 Pln | |
| BLDpharm | 25mg | 3007.85 Pln | |
| BLDpharm | 50mg | 4812.77 Pln | |
| BLDpharm | 100mg | 8144.93 Pln | |
| Chemat | 2mg | 669.20 Pln | |
| Chemat | 5mg | 1096.40 Pln | |
| Chemat | 10mg | 1816.40 Pln | |
| Chemat | 25mg | 3045.20 Pln | |
| Chemat | 50mg | 5128.40 Pln | |
| Chemat | 100mg | 8675.60 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
N-[(1R,2R,3S)-2-hydroxy-3-phenoxazin-10-ylcyclohexyl]-4-(trifluoromethoxy)benzenesulfonamide (CAS 1809427-19-7) is a chemical compound with the molecular formula C25H23F3N2O5S and a molecular weight of 520.5 g/mol. IUPAC name: N-[(1R,2R,3S)-2-hydroxy-3-phenoxazin-10-ylcyclohexyl]-4-(trifluoromethoxy)benzenesulfonamide. InChIKey: WGKGADVPRVLHHZ-ZHRMCQFGSA-N.
| Molecular formula | C25H23F3N2O5S |
|---|---|
| Molecular weight | 520.5 g/mol |
| IUPAC name | N-[(1R,2R,3S)-2-hydroxy-3-phenoxazin-10-ylcyclohexyl]-4-(trifluoromethoxy)benzenesulfonamide |
| InChIKey | WGKGADVPRVLHHZ-ZHRMCQFGSA-N |
| SMILES | C1C[C@H]([C@@H]([C@H](C1)N2C3=CC=CC=C3OC4=CC=CC=C42)O)NS(=O)(=O)C5=CC=C(C=C5)OC(F)(F)F |
Computed by PubChem (NCBI)