cas: 853994-53-3 — see every product listed under this CAS number, including other names
N-(2,4-Dimethoxybenzyl)thiazol-2-amine, 98% (CAS 853994-53-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F463203-100MG |
| cas | 853994-53-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 393.63 Pln | |
| Fluorochem | 250mg | 732.05 Pln | |
| Fluorochem | 1g | 1752.53 Pln | |
| Fluorochem | 5g | 5152.37 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
N-[(2,4-dimethoxyphenyl)methyl]-1,3-thiazol-2-amine (CAS 853994-53-3) is a chemical compound with the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. IUPAC name: N-[(2,4-dimethoxyphenyl)methyl]-1,3-thiazol-2-amine. InChIKey: XLLWLGOTZJZAHB-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O2S |
|---|---|
| Molecular weight | 250.32 g/mol |
| IUPAC name | N-[(2,4-dimethoxyphenyl)methyl]-1,3-thiazol-2-amine |
| InChIKey | XLLWLGOTZJZAHB-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)CNC2=NC=CS2)OC |
Computed by PubChem (NCBI)