cas: 97528-24-0 — see every product listed under this CAS number, including other names
N-(2,4-Dimethylphenyl)pivalamide 98% (CAS 97528-24-0) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A476984-5g |
| cas | 97528-24-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 203.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A476984 |
N-(2,4-dimethylphenyl)-2,2-dimethylpropanamide (CAS 97528-24-0) is a chemical compound with the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. IUPAC name: N-(2,4-dimethylphenyl)-2,2-dimethylpropanamide. InChIKey: UNNKNOWVLKOZRO-UHFFFAOYSA-N.
| Molecular formula | C13H19NO |
|---|---|
| Molecular weight | 205.30 g/mol |
| IUPAC name | N-(2,4-dimethylphenyl)-2,2-dimethylpropanamide |
| InChIKey | UNNKNOWVLKOZRO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC(=O)C(C)(C)C)C |
Computed by PubChem (NCBI)