cas: 127243-85-0 — see every product listed under this CAS number, including other names
N-(2-((3-(4-Bromophenyl)allyl)amino)ethyl)isoquinoline-5-sulfonamide, 98%, 98% (CAS 127243-85-0) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111WT3-10mg |
| cas | 127243-85-0 |
| size | 10mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 112.40 Pln | |
| Chemat | 50mg | 290.00 Pln | |
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 928.40 Pln | |
| Chemat | 1g | 2723.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-[2-[[(E)-3-(4-bromophenyl)prop-2-enyl]amino]ethyl]isoquinoline-5-sulfonamide (CAS 127243-85-0) is a chemical compound with the molecular formula C20H20BrN3O2S and a molecular weight of 446.4 g/mol. IUPAC name: N-[2-[[(E)-3-(4-bromophenyl)prop-2-enyl]amino]ethyl]isoquinoline-5-sulfonamide. InChIKey: ZKZXNDJNWUTGDK-NSCUHMNNSA-N.
| Molecular formula | C20H20BrN3O2S |
|---|---|
| Molecular weight | 446.4 g/mol |
| IUPAC name | N-[2-[[(E)-3-(4-bromophenyl)prop-2-enyl]amino]ethyl]isoquinoline-5-sulfonamide |
| InChIKey | ZKZXNDJNWUTGDK-NSCUHMNNSA-N |
| SMILES | C1=CC2=C(C=CN=C2)C(=C1)S(=O)(=O)NCCNC/C=C/C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)