cas: 1256037-07-6 — see every product listed under this CAS number, including other names
N-(2-Acetyl-3,4-dimethoxyphenyl)-3-fluorobenzamide, 95%, 95% (CAS 1256037-07-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111NXR-100mg |
| cas | 1256037-07-6 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-(2-acetyl-3,4-dimethoxyphenyl)-3-fluorobenzamide (CAS 1256037-07-6) is a chemical compound with the molecular formula C17H16FNO4 and a molecular weight of 317.31 g/mol. IUPAC name: N-(2-acetyl-3,4-dimethoxyphenyl)-3-fluorobenzamide. InChIKey: AXYKZHXKGGMYKM-UHFFFAOYSA-N.
| Molecular formula | C17H16FNO4 |
|---|---|
| Molecular weight | 317.31 g/mol |
| IUPAC name | N-(2-acetyl-3,4-dimethoxyphenyl)-3-fluorobenzamide |
| InChIKey | AXYKZHXKGGMYKM-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1OC)OC)NC(=O)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)