cas: 874459-63-9 — see every product listed under this CAS number, including other names
N-(2-BOC-AMINOETHYL) 4-BORONOBENZENESULFONAMIDE, 96%, 96% (CAS 874459-63-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IELB-100mg |
| cas | 874459-63-9 |
| size | 100mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 304.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfamoyl]phenyl]boronic acid (CAS 874459-63-9) is a chemical compound with the molecular formula C13H21BN2O6S and a molecular weight of 344.2 g/mol. IUPAC name: [4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfamoyl]phenyl]boronic acid. InChIKey: LCECEUBTMRPCGY-UHFFFAOYSA-N.
| Molecular formula | C13H21BN2O6S |
|---|---|
| Molecular weight | 344.2 g/mol |
| IUPAC name | [4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfamoyl]phenyl]boronic acid |
| InChIKey | LCECEUBTMRPCGY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)NCCNC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)