N-(2-Chloro-4-((6,7-dimethoxyquinazolin-4-yl)oxy)phenyl)-2-(4-(trifluoromethyl)phenyl)acetamide, 95%
cas: 3059568-06-5 — see every product listed under this CAS number, including other names
N-(2-Chloro-4-((6,7-dimethoxyquinazolin-4-yl)oxy)phenyl)-2-(4-(trifluoromethyl)phenyl)acetamide, 95% (CAS 3059568-06-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A13809332-100mg |
| cas | 3059568-06-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 192.38 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 620.69 Pln | |
| Ambeed | 5g | 1888.94 Pln | |
| Ambeed | 10g | 3162.75 Pln | |
| Ambeed | 25g | 6238.81 Pln | |
| BLDpharm | 100mg | 203.29 Pln | |
| BLDpharm | 250mg | 297.70 Pln | |
| BLDpharm | 1g | 664.24 Pln | |
| BLDpharm | 5g | 2030.42 Pln | |
| BLDpharm | 10g | 3402.16 Pln | |
| BLDpharm | 25g | 6723.21 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
N-[2-chloro-4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-2-[4-(trifluoromethyl)phenyl]acetamide (CAS 3059568-06-5) is a chemical compound with the molecular formula C25H19ClF3N3O4 and a molecular weight of 517.9 g/mol. IUPAC name: N-[2-chloro-4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-2-[4-(trifluoromethyl)phenyl]acetamide. InChIKey: BBRRFMQFKGRGSA-UHFFFAOYSA-N.
| Molecular formula | C25H19ClF3N3O4 |
|---|---|
| Molecular weight | 517.9 g/mol |
| IUPAC name | N-[2-chloro-4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
| InChIKey | BBRRFMQFKGRGSA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)OC3=CC(=C(C=C3)NC(=O)CC4=CC=C(C=C4)C(F)(F)F)Cl)OC |
Computed by PubChem (NCBI)