cas: 2096341-87-4 — see every product listed under this CAS number, including other names
N-(2-Chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)cyclopentanamine 95% (CAS 2096341-87-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A875739-250mg |
| cas | 2096341-87-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1010.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A875739 |
N-[[2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopentanamine (CAS 2096341-87-4) is a chemical compound with the molecular formula C18H27BClNO2 and a molecular weight of 335.7 g/mol. IUPAC name: N-[[2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopentanamine. InChIKey: LMUCKXMENJYEKG-UHFFFAOYSA-N.
| Molecular formula | C18H27BClNO2 |
|---|---|
| Molecular weight | 335.7 g/mol |
| IUPAC name | N-[[2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopentanamine |
| InChIKey | LMUCKXMENJYEKG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)CNC3CCCC3)Cl |
Computed by PubChem (NCBI)