cas: 2246772-82-5 — see every product listed under this CAS number, including other names
N-(2-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ethanesulfonamide, 98% (CAS 2246772-82-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1356959-5g |
| cas | 2246772-82-5 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 23681.77 Pln | |
| Fluorochem | 250mg | 1528.65 Pln | |
| Fluorochem | 1g | 3246.79 Pln | |
| Fluorochem | 5g | 10947.20 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide (CAS 2246772-82-5) is a chemical compound with the molecular formula C14H21BFNO4S and a molecular weight of 329.2 g/mol. IUPAC name: N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide. InChIKey: ILUZMWXSVTUWCY-UHFFFAOYSA-N.
| Molecular formula | C14H21BFNO4S |
|---|---|
| Molecular weight | 329.2 g/mol |
| IUPAC name | N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide |
| InChIKey | ILUZMWXSVTUWCY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)NS(=O)(=O)CC)F |
Computed by PubChem (NCBI)