cas: 5279-85-6 — see every product listed under this CAS number, including other names
N-(2-Fluorophenyl)-3-oxobutanamide, 95%+, 95%+ (CAS 5279-85-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DCWX-50mg |
| cas | 5279-85-6 |
| size | 50mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 184.40 Pln | |
| Chemat | 250mg | 477.20 Pln | |
| Chemat | 1g | 1254.80 Pln | |
| Chemat | 5g | 4600.40 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
N-(2-fluorophenyl)-3-oxobutanamide (CAS 5279-85-6) is a chemical compound with the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. IUPAC name: N-(2-fluorophenyl)-3-oxobutanamide. InChIKey: SNNJOLBZQNBODQ-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO2 |
|---|---|
| Molecular weight | 195.19 g/mol |
| IUPAC name | N-(2-fluorophenyl)-3-oxobutanamide |
| InChIKey | SNNJOLBZQNBODQ-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)NC1=CC=CC=C1F |
Computed by PubChem (NCBI)