cas: 2246900-42-3 — see every product listed under this CAS number, including other names
N-(2-METHOXY-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL)ETHANESULFONAMIDE, 97% (CAS 2246900-42-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F817797-100MG |
| cas | 2246900-42-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 737.26 Pln | |
| Fluorochem | 250mg | 1205.84 Pln | |
| Fluorochem | 1g | 3501.91 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
N-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide (CAS 2246900-42-3) is a chemical compound with the molecular formula C15H24BNO5S and a molecular weight of 341.2 g/mol. IUPAC name: N-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide. InChIKey: MWWDOUMFMHWHKU-UHFFFAOYSA-N.
| Molecular formula | C15H24BNO5S |
|---|---|
| Molecular weight | 341.2 g/mol |
| IUPAC name | N-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide |
| InChIKey | MWWDOUMFMHWHKU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)NS(=O)(=O)CC)OC |
Computed by PubChem (NCBI)