cas: 1534377-39-3 — see every product listed under this CAS number, including other names
N-(2-Methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanesulfonamide 95% (CAS 1534377-39-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1356928-250mg |
| cas | 1534377-39-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1310.44 Pln | |
| Ambeed | 1g | 2473.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1356928 |
N-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide (CAS 1534377-39-3) is a chemical compound with the molecular formula C14H22BNO5S and a molecular weight of 327.2 g/mol. IUPAC name: N-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide. InChIKey: YXKKYTCXFCNSBN-UHFFFAOYSA-N.
| Molecular formula | C14H22BNO5S |
|---|---|
| Molecular weight | 327.2 g/mol |
| IUPAC name | N-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide |
| InChIKey | YXKKYTCXFCNSBN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)NS(=O)(=O)C)OC |
Computed by PubChem (NCBI)