cas: 2245819-88-7 — see every product listed under this CAS number, including other names
N-(2-Methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)propane-1-sulfonamide, 95-<97% (CAS 2245819-88-7) is a chemical reagent available from Chemat. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC1067-95-97-2.5g |
| cas | 2245819-88-7 |
| size | 2,5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 2,5g | 4206.18 Pln | |
| Hoffman Fine Chemicals | 5g | 6541.26 Pln | |
| Hoffman Fine Chemicals | 10g | 10286.32 Pln | |
| Hoffman Fine Chemicals | 25g | 20258.26 Pln | |
| Hoffman Fine Chemicals | 50g | 34224.08 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
N-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-1-sulfonamide (CAS 2245819-88-7) is a chemical compound with the molecular formula C16H26BNO5S and a molecular weight of 355.3 g/mol. IUPAC name: N-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-1-sulfonamide. InChIKey: OYUBSUCMLYQJFR-UHFFFAOYSA-N.
| Molecular formula | C16H26BNO5S |
|---|---|
| Molecular weight | 355.3 g/mol |
| IUPAC name | N-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-1-sulfonamide |
| InChIKey | OYUBSUCMLYQJFR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)NS(=O)(=O)CCC)OC |
Computed by PubChem (NCBI)