cas: 269410-12-0 — see every product listed under this CAS number, including other names
N-(2-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetamide (CAS 269410-12-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627307-1G |
| cas | 269410-12-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 4236.03 Pln | |
| Fluorochem | 5g | 12571.63 Pln |
| delivery time | 3-4 weeks |
|---|
N-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (CAS 269410-12-0) is a chemical compound with the molecular formula C15H22BNO3 and a molecular weight of 275.15 g/mol. IUPAC name: N-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide. InChIKey: QHXHAVFEASRUSU-UHFFFAOYSA-N.
| Molecular formula | C15H22BNO3 |
|---|---|
| Molecular weight | 275.15 g/mol |
| IUPAC name | N-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| InChIKey | QHXHAVFEASRUSU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)NC(=O)C)C |
Computed by PubChem (NCBI)