cas: 125867-19-8 — see every product listed under this CAS number, including other names
N-(2-methoxypyridin-3-yl)pivalamide, 95%, 95% (CAS 125867-19-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111OWP-50mg |
| cas | 125867-19-8 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 486.80 Pln | |
| Chemat | 100mg | 616.40 Pln | |
| Chemat | 250mg | 1206.80 Pln | |
| Chemat | 1g | 3794.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-(2-methoxy-3-pyridinyl)-2,2-dimethylpropanamide (CAS 125867-19-8) is a chemical compound with the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. IUPAC name: N-(2-methoxy-3-pyridinyl)-2,2-dimethylpropanamide. InChIKey: FPRBOVWSWSYETA-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | N-(2-methoxy-3-pyridinyl)-2,2-dimethylpropanamide |
| InChIKey | FPRBOVWSWSYETA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(N=CC=C1)OC |
Computed by PubChem (NCBI)