cas: 63368-54-7 — see every product listed under this CAS number, including other names
N-(3',6'-Dihydroxy-3-oxo-3H-spiro[isobenzofuran-1,9'-xanthen]-5-yl)-2-iodoacetamide, 90+% (CAS 63368-54-7) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: BLDpharm, Chemat.
| brand | BLDpharm |
|---|---|
| catalog number | BD417715-5mg |
| cas | 63368-54-7 |
| size | 5mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 5mg | 436.54 Pln | |
| BLDpharm | 10mg | 658.68 Pln | |
| BLDpharm | 25mg | 1180.72 Pln | |
| BLDpharm | 50mg | 1852.71 Pln | |
| BLDpharm | 100mg | 2924.55 Pln | |
| BLDpharm | 250mg | 5490.31 Pln | |
| Chemat | 5mg | 414.80 Pln | |
| Chemat | 10mg | 626.00 Pln | |
| Chemat | 25mg | 1134.80 Pln | |
| Chemat | 50mg | 1778.00 Pln | |
| Chemat | 100mg | 2805.20 Pln | |
| Chemat | 250mg | 5272.40 Pln |
| purity | 90+% |
|---|---|
| delivery time | 3-4 weeks |
N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-2-iodoacetamide (CAS 63368-54-7) is a chemical compound with the molecular formula C22H14INO6 and a molecular weight of 515.3 g/mol. IUPAC name: N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-2-iodoacetamide. InChIKey: UATCLPJEZJKNHE-UHFFFAOYSA-N.
| Molecular formula | C22H14INO6 |
|---|---|
| Molecular weight | 515.3 g/mol |
| IUPAC name | N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-2-iodoacetamide |
| InChIKey | UATCLPJEZJKNHE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1NC(=O)CI)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O |
Computed by PubChem (NCBI)