N-(3,5-Dichloro-4-iodophenyl)acetamide, 97+%
cas: 89894-32-6 — see every product listed under this CAS number, including other names
N-(3,5-Dichloro-4-iodophenyl)acetamide, 97+% (CAS 89894-32-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1482803-100mg |
| cas | 89894-32-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 192.38 Pln | |
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 448.25 Pln | |
| Ambeed | 5g | 1405.00 Pln | |
| Ambeed | 10g | 2200.44 Pln | |
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 1g | 501.20 Pln | |
| Chemat | 5g | 1590.80 Pln | |
| BLDpharm | 100mg | 181.07 Pln | |
| BLDpharm | 250mg | 247.72 Pln | |
| BLDpharm | 1g | 480.97 Pln | |
| BLDpharm | 5g | 1508.38 Pln | |
| BLDpharm | 10g | 2369.19 Pln |
properties
| purity | 97+% |
|---|---|
| delivery time | 1-2 weeks |
N-(3,5-dichloro-4-iodophenyl)acetamide (CAS 89894-32-6) is a chemical compound with the molecular formula C8H6Cl2INO and a molecular weight of 329.95 g/mol. IUPAC name: N-(3,5-dichloro-4-iodophenyl)acetamide. InChIKey: QRSKIQFTCZAYMS-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2INO |
|---|---|
| Molecular weight | 329.95 g/mol |
| IUPAC name | N-(3,5-dichloro-4-iodophenyl)acetamide |
| InChIKey | QRSKIQFTCZAYMS-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C(=C1)Cl)I)Cl |
Computed by PubChem (NCBI)