cas: 86847-63-4 — see every product listed under this CAS number, including other names
N-(3-(Trimethylsilyl)pyridin-2-yl)pivalamide, 95%, 95% (CAS 86847-63-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115IQ0-100mg |
| cas | 86847-63-4 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 381.20 Pln | |
| Chemat | 1g | 990.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,2-dimethyl-N-(3-trimethylsilyl-2-pyridinyl)propanamide (CAS 86847-63-4) is a chemical compound with the molecular formula C13H22N2OSi and a molecular weight of 250.41 g/mol. IUPAC name: 2,2-dimethyl-N-(3-trimethylsilyl-2-pyridinyl)propanamide. InChIKey: WJGJZDHOKCDEGB-UHFFFAOYSA-N.
| Molecular formula | C13H22N2OSi |
|---|---|
| Molecular weight | 250.41 g/mol |
| IUPAC name | 2,2-dimethyl-N-(3-trimethylsilyl-2-pyridinyl)propanamide |
| InChIKey | WJGJZDHOKCDEGB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C=CC=N1)[Si](C)(C)C |
Computed by PubChem (NCBI)