cas: 307524-60-3 — see every product listed under this CAS number, including other names
N-(3-Acetylphenyl)adamantane-1-carboxamide 97% (CAS 307524-60-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A770488-250mg |
| cas | 307524-60-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 403.75 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 2000.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A770488 |
N-(3-acetylphenyl)adamantane-1-carboxamide (CAS 307524-60-3) is a chemical compound with the molecular formula C19H23NO2 and a molecular weight of 297.4 g/mol. IUPAC name: N-(3-acetylphenyl)adamantane-1-carboxamide. InChIKey: POYKJYUHIMNWKW-UHFFFAOYSA-N.
| Molecular formula | C19H23NO2 |
|---|---|
| Molecular weight | 297.4 g/mol |
| IUPAC name | N-(3-acetylphenyl)adamantane-1-carboxamide |
| InChIKey | POYKJYUHIMNWKW-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)NC(=O)C23CC4CC(C2)CC(C4)C3 |
Computed by PubChem (NCBI)