cas: 38353-79-6 — see every product listed under this CAS number, including other names
N-(3-Aminopropyl)-4-methylbenzenesulfonamide hydrochloride 95% (CAS 38353-79-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1521443-250mg |
| cas | 38353-79-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 1010.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1521443 |
N-(3-aminopropyl)-4-methylbenzenesulfonamide;hydrochloride (CAS 38353-79-6) is a chemical compound with the molecular formula C10H17ClN2O2S and a molecular weight of 264.77 g/mol. IUPAC name: N-(3-aminopropyl)-4-methylbenzenesulfonamide;hydrochloride. InChIKey: KWJSZMCJYDVVCI-UHFFFAOYSA-N.
| Molecular formula | C10H17ClN2O2S |
|---|---|
| Molecular weight | 264.77 g/mol |
| IUPAC name | N-(3-aminopropyl)-4-methylbenzenesulfonamide;hydrochloride |
| InChIKey | KWJSZMCJYDVVCI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NCCCN.Cl |
Computed by PubChem (NCBI)