cas: 2096334-42-6 — see every product listed under this CAS number, including other names
N-(3-Chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)cyclohexanamine 96% (CAS 2096334-42-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A551095-100mg |
| cas | 2096334-42-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 353.69 Pln | |
| Ambeed | 5g | 854.31 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A551095 |
N-[[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclohexanamine (CAS 2096334-42-6) is a chemical compound with the molecular formula C19H29BClNO2 and a molecular weight of 349.7 g/mol. IUPAC name: N-[[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclohexanamine. InChIKey: DWPRAXKEEPZKFD-UHFFFAOYSA-N.
| Molecular formula | C19H29BClNO2 |
|---|---|
| Molecular weight | 349.7 g/mol |
| IUPAC name | N-[[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclohexanamine |
| InChIKey | DWPRAXKEEPZKFD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)CNC3CCCCC3)Cl |
Computed by PubChem (NCBI)