cas: 2096337-34-5 — see every product listed under this CAS number, including other names
N-(3-Chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)cyclopentanamine 95% (CAS 2096337-34-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A882509-250mg |
| cas | 2096337-34-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 698.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A882509 |
N-[[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopentanamine (CAS 2096337-34-5) is a chemical compound with the molecular formula C18H27BClNO2 and a molecular weight of 335.7 g/mol. IUPAC name: N-[[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopentanamine. InChIKey: VSJUQHMCWKBJQF-UHFFFAOYSA-N.
| Molecular formula | C18H27BClNO2 |
|---|---|
| Molecular weight | 335.7 g/mol |
| IUPAC name | N-[[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopentanamine |
| InChIKey | VSJUQHMCWKBJQF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)CNC3CCCC3)Cl |
Computed by PubChem (NCBI)