cas: 2246657-45-2 — see every product listed under this CAS number, including other names
N-(3-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)cyclohexanecarboxamide, 95%, 95% (CAS 2246657-45-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FFXP-250mg |
| cas | 2246657-45-2 |
| size | 250mg |
| availability | 8.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 875.60 Pln | |
| Chemat | 1g | 1782.80 Pln | |
| Chemat | 5g | 5229.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexanecarboxamide (CAS 2246657-45-2) is a chemical compound with the molecular formula C19H27BFNO3 and a molecular weight of 347.2 g/mol. IUPAC name: N-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexanecarboxamide. InChIKey: DFJXRGKSAMWMPC-UHFFFAOYSA-N.
| Molecular formula | C19H27BFNO3 |
|---|---|
| Molecular weight | 347.2 g/mol |
| IUPAC name | N-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexanecarboxamide |
| InChIKey | DFJXRGKSAMWMPC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)NC(=O)C3CCCCC3)F |
Computed by PubChem (NCBI)