cas: 765949-02-8 — see every product listed under this CAS number, including other names
N-(3-Methylphenyl)-N′-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)urea, 95-<97% (CAS 765949-02-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC890-95-97-1g |
| cas | 765949-02-8 |
| size | 1g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 1g | 3376.78 Pln | |
| Hoffman Fine Chemicals | 2,5g | 6707.14 Pln | |
| Hoffman Fine Chemicals | 5g | 10541.52 Pln | |
| Hoffman Fine Chemicals | 10g | 16685.46 Pln | |
| Hoffman Fine Chemicals | 25g | 33062.92 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
1-(3-methylphenyl)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea (CAS 765949-02-8) is a chemical compound with the molecular formula C20H25BN2O3 and a molecular weight of 352.2 g/mol. IUPAC name: 1-(3-methylphenyl)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea. InChIKey: RRBQRXSUDSDIMI-UHFFFAOYSA-N.
| Molecular formula | C20H25BN2O3 |
|---|---|
| Molecular weight | 352.2 g/mol |
| IUPAC name | 1-(3-methylphenyl)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
| InChIKey | RRBQRXSUDSDIMI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NC(=O)NC3=CC=CC(=C3)C |
Computed by PubChem (NCBI)