cas: 178403-35-5 — see every product listed under this CAS number, including other names
N-(4,6-Dimethoxy-2-pyrimidinyl)-N-[3-(trifluoromethyl)-2-pyridinyl]urea, 95%, 95% (CAS 178403-35-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114AR9-100mg |
| cas | 178403-35-5 |
| size | 100mg |
| availability | 1.4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1782.80 Pln | |
| Chemat | 250mg | 3165.20 Pln | |
| Chemat | 1g | 4542.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(4,6-dimethoxypyrimidin-2-yl)-1-[3-(trifluoromethyl)-2-pyridinyl]urea (CAS 178403-35-5) is a chemical compound with the molecular formula C13H12F3N5O3 and a molecular weight of 343.26 g/mol. IUPAC name: 1-(4,6-dimethoxypyrimidin-2-yl)-1-[3-(trifluoromethyl)-2-pyridinyl]urea. InChIKey: WIGINONAXQYKLJ-UHFFFAOYSA-N.
| Molecular formula | C13H12F3N5O3 |
|---|---|
| Molecular weight | 343.26 g/mol |
| IUPAC name | 1-(4,6-dimethoxypyrimidin-2-yl)-1-[3-(trifluoromethyl)-2-pyridinyl]urea |
| InChIKey | WIGINONAXQYKLJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=NC(=N1)N(C2=C(C=CC=N2)C(F)(F)F)C(=O)N)OC |
Computed by PubChem (NCBI)