cas: 935660-75-6 — see every product listed under this CAS number, including other names
N-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)benzamide, 95% (CAS 935660-75-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225263-250MG |
| cas | 935660-75-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 1g | 409.25 Pln | |
| Fluorochem | 5g | 1263.11 Pln | |
| Fluorochem | 10g | 2471.02 Pln | |
| Fluorochem | 25g | 6094.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide (CAS 935660-75-6) is a chemical compound with the molecular formula C19H22BNO3 and a molecular weight of 323.2 g/mol. IUPAC name: N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide. InChIKey: BRERQYZGASSZJR-UHFFFAOYSA-N.
| Molecular formula | C19H22BNO3 |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide |
| InChIKey | BRERQYZGASSZJR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)