cas: 2268696-54-2 — see every product listed under this CAS number, including other names
N-(4-Bromophenyl)-2-fluoroaniline, ≥97% (CAS 2268696-54-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12XF1T-100mg |
| cas | 2268696-54-2 |
| size | 100mg |
| availability | 50g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 381.20 Pln | |
| Chemat | 250mg | 477.20 Pln | |
| Chemat | 1g | 1096.40 Pln | |
| Chemat | 5g | 2579.60 Pln | |
| Chemat | 10g | 3851.60 Pln | |
| Chemat | 25g | 7643.60 Pln | |
| Fluorochem | 100mg | 695.61 Pln | |
| Fluorochem | 250mg | 872.63 Pln | |
| Fluorochem | 1g | 2028.47 Pln | |
| Fluorochem | 5g | 4772.30 Pln | |
| Fluorochem | 10g | 7011.09 Pln | |
| Fluorochem | 25g | 13951.36 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
N-(4-bromophenyl)-2-fluoroaniline (CAS 2268696-54-2) is a chemical compound with the molecular formula C12H9BrFN and a molecular weight of 266.11 g/mol. IUPAC name: N-(4-bromophenyl)-2-fluoroaniline. InChIKey: NCWNPGAVLCQCNK-UHFFFAOYSA-N.
| Molecular formula | C12H9BrFN |
|---|---|
| Molecular weight | 266.11 g/mol |
| IUPAC name | N-(4-bromophenyl)-2-fluoroaniline |
| InChIKey | NCWNPGAVLCQCNK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC2=CC=C(C=C2)Br)F |
Computed by PubChem (NCBI)