cas: 1409999-52-5 — see every product listed under this CAS number, including other names
N-(4-Chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)pivalamide 98% (CAS 1409999-52-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A638669-100mg |
| cas | 1409999-52-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 637.38 Pln | |
| Ambeed | 250mg | 1199.19 Pln | |
| Ambeed | 1g | 2333.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A638669 |
N-[4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,2-dimethylpropanamide (CAS 1409999-52-5) is a chemical compound with the molecular formula C17H25BClNO3 and a molecular weight of 337.6 g/mol. IUPAC name: N-[4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,2-dimethylpropanamide. InChIKey: XFYJYUOGOHTUJP-UHFFFAOYSA-N.
| Molecular formula | C17H25BClNO3 |
|---|---|
| Molecular weight | 337.6 g/mol |
| IUPAC name | N-[4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,2-dimethylpropanamide |
| InChIKey | XFYJYUOGOHTUJP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)Cl)NC(=O)C(C)(C)C |
Computed by PubChem (NCBI)