cas: 149765-16-2 — see every product listed under this CAS number, including other names
N-(4-Chloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidin-2-yl)pivalamide 95% (CAS 149765-16-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A188849-100mg |
| cas | 149765-16-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1588.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A188849 |
N-(4-chloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethylpropanamide (CAS 149765-16-2) is a chemical compound with the molecular formula C11H12ClIN4O and a molecular weight of 378.60 g/mol. IUPAC name: N-(4-chloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethylpropanamide. InChIKey: KZDHRXDFCHHFEJ-UHFFFAOYSA-N.
| Molecular formula | C11H12ClIN4O |
|---|---|
| Molecular weight | 378.60 g/mol |
| IUPAC name | N-(4-chloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,2-dimethylpropanamide |
| InChIKey | KZDHRXDFCHHFEJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=NC2=C(C(=CN2)I)C(=N1)Cl |
Computed by PubChem (NCBI)